About 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid
3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid (PubChem CID 105431846) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid.
Analyze 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid?
The IUPAC name of 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid (CID 105431846) is 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid.
What is the SMILES notation for 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid?
The canonical SMILES for 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid is Cc1ccc2c(c1)CC2C(=O)O.
What is the InChIKey of 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid?
The InChIKey is WVILCZPIPZLVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-6-2-3-8-7(4-6)5-9(8)10(11)12/h2-4,9H,5H2,1H3,(H,11,12).
What are the key properties of 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid?
3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid has a molecular weight of 162.19 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid is sourced from PubChem (CID 105431846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).