C6H6N4O — CID 143285060
2-methyl-1H-pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 143285060) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-methyl-1H-pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 2-methyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 143285060 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-methyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | Cn1[nH]c2ncncc2c1=O |
| InChI | InChI=1S/C6H6N4O/c1-10-6(11)4-2-7-3-8-5(4)9-10/h2-3H,1H3,(H,7,8,9) |
| InChIKey | DOZWYAGXOHUOQH-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|