C6H3N3O2S — CID 175871069
1H-pyrimido[4,5-d][1,3]thiazine-2,4-dione (PubChem CID 175871069) has the molecular formula C6H3N3O2S and a molecular weight of 181.18 g/mol. Its IUPAC name is 1H-pyrimido[4,5-d][1,3]thiazine-2,4-dione.
| Compound Name | 1H-pyrimido[4,5-d][1,3]thiazine-2,4-dione |
|---|---|
| PubChem CID | 175871069 |
| Molecular Formula | C6H3N3O2S |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 180.99 |
| IUPAC Name | 1H-pyrimido[4,5-d][1,3]thiazine-2,4-dione |
| SMILES | O=c1[nH]c2ncncc2c(=O)s1 |
| InChI | InChI=1S/C6H3N3O2S/c10-5-3-1-7-2-8-4(3)9-6(11)12-5/h1-2H,(H,7,8,9,11) |
| InChIKey | WEPNNYGAROZHIS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |