C7H6N4S — CID 19431529
7H-pyrrolo[2,3-d]pyrimidine-5-carbothioamide (PubChem CID 19431529) has the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. Its IUPAC name is 7H-pyrrolo[2,3-d]pyrimidine-5-carbothioamide.
| Compound Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 19431529 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 7H-pyrrolo[2,3-d]pyrimidine-5-carbothioamide |
| SMILES | NC(=S)c1c[nH]c2ncncc12 |
| InChI | InChI=1S/C7H6N4S/c8-6(12)4-2-10-7-5(4)1-9-3-11-7/h1-3H,(H2,8,12)(H,9,10,11) |
| InChIKey | IQGRKVBHCRCUPS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|