C7H9N5OS — CID 130541201
2-[(5-carbamothioylpyrimidin-4-yl)amino]acetamide (PubChem CID 130541201) has the molecular formula C7H9N5OS and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-[(5-carbamothioylpyrimidin-4-yl)amino]acetamide.
| Compound Name | 2-[(5-carbamothioylpyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 130541201 |
| Molecular Formula | C7H9N5OS |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-[(5-carbamothioylpyrimidin-4-yl)amino]acetamide |
| SMILES | NC(=O)CNc1ncncc1C(N)=S |
| InChI | InChI=1S/C7H9N5OS/c8-5(13)2-11-7-4(6(9)14)1-10-3-12-7/h1,3H,2H2,(H2,8,13)(H2,9,14)(H,10,11,12) |
| InChIKey | NHPUPNKJNMAWEC-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|