About 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide
4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide (PubChem CID 90839382) has the molecular formula C7H7F3N4O
and a molecular weight of 220.15 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide |
| PubChem CID | 90839382 |
| Molecular Formula | C7H7F3N4O |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cncnc1NCC(F)(F)F |
| InChI | InChI=1S/C7H7F3N4O/c8-7(9,10)2-13-6-4(5(11)15)1-12-3-14-6/h1,3H,2H2,(H2,11,15)(H,12,13,14) |
| InChIKey | SBWKOCLNVVZXIF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide?
The IUPAC name of 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide (CID 90839382) is 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide.
What is the SMILES notation for 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide?
The canonical SMILES for 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide is NC(=O)c1cncnc1NCC(F)(F)F.
What is the InChIKey of 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide?
The InChIKey is SBWKOCLNVVZXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N4O/c8-7(9,10)2-13-6-4(5(11)15)1-12-3-14-6/h1,3H,2H2,(H2,11,15)(H,12,13,14).
What are the key properties of 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide?
4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide has a molecular weight of 220.15 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoroethylamino)pyrimidine-5-carboxamide is sourced from PubChem (CID 90839382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).