C11H16N4O2 — CID 142718123
4-[[(1R,3S)-3-hydroxycyclohexyl]amino]pyrimidine-5-carboxamide (PubChem CID 142718123) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-hydroxycyclohexyl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1R,3S)-3-hydroxycyclohexyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142718123 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-[[(1R,3S)-3-hydroxycyclohexyl]amino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cncnc1N[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C11H16N4O2/c12-10(17)9-5-13-6-14-11(9)15-7-2-1-3-8(16)4-7/h5-8,16H,1-4H2,(H2,12,17)(H,13,14,15)/t7-,8+/m1/s1 |
| InChIKey | UGMPRJNDRUQPPU-SFYZADRCSA-N |
| XLogP | 0.29 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |