C16H24N4O3 — CID 167147038
6-[(2-hydroxycyclobutyl)amino]-4-[(3-hydroxycyclohexyl)amino]pyridine-3-carboxamide (PubChem CID 167147038) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-[(2-hydroxycyclobutyl)amino]-4-[(3-hydroxycyclohexyl)amino]pyridine-3-carboxamide.
| Compound Name | 6-[(2-hydroxycyclobutyl)amino]-4-[(3-hydroxycyclohexyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167147038 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 6-[(2-hydroxycyclobutyl)amino]-4-[(3-hydroxycyclohexyl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NC2CCC2O)cc1NC1CCCC(O)C1 |
| InChI | InChI=1S/C16H24N4O3/c17-16(23)11-8-18-15(20-12-4-5-14(12)22)7-13(11)19-9-2-1-3-10(21)6-9/h7-10,12,14,21-22H,1-6H2,(H2,17,23)(H2,18,19,20) |
| InChIKey | JDRNXXRBOFESPF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |