About [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone
[6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone (PubChem CID 167425574) has the molecular formula C15H19ClN2O2
and a molecular weight of 294.78 g/mol. Its IUPAC name is [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone.
Molecular Properties
| Compound Name | [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone |
| PubChem CID | 167425574 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone |
| SMILES | O=C(c1cnc(Cl)cc1N[C@@H]1CCC[C@H](O)C1)C1CC1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-14-7-13(18-10-2-1-3-11(19)6-10)12(8-17-14)15(20)9-4-5-9/h7-11,19H,1-6H2,(H,17,18)/t10-,11+/m1/s1 |
| InChIKey | RGMCDGXWOCVEQD-MNOVXSKESA-N |
| XLogP | 3.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone?
The IUPAC name of [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone (CID 167425574) is [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone.
What is the SMILES notation for [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone?
The canonical SMILES for [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone is O=C(c1cnc(Cl)cc1N[C@@H]1CCC[C@H](O)C1)C1CC1.
What is the InChIKey of [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone?
The InChIKey is RGMCDGXWOCVEQD-MNOVXSKESA-N. The full InChI is InChI=1S/C15H19ClN2O2/c16-14-7-13(18-10-2-1-3-11(19)6-10)12(8-17-14)15(20)9-4-5-9/h7-11,19H,1-6H2,(H,17,18)/t10-,11+/m1/s1.
What are the key properties of [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone?
[6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone has a molecular weight of 294.78 g/mol, XLogP of 3.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-[[(1R,3S)-3-hydroxycyclohexyl]amino]-3-pyridinyl]-cyclopropylmethanone is sourced from PubChem (CID 167425574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).