C12H15Cl2N3O4 — CID 86692809
4-[(2-chloro-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxylic acid;hydrochloride (PubChem CID 86692809) has the molecular formula C12H15Cl2N3O4 and a molecular weight of 336.18 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxylic acid;hydrochloride.
| Compound Name | 4-[(2-chloro-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 86692809 |
| Molecular Formula | C12H15Cl2N3O4 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-[(2-chloro-5-nitro-4-pyridinyl)amino]cyclohexane-1-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCC(Nc2cc(Cl)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H14ClN3O4.ClH/c13-11-5-9(10(6-14-11)16(19)20)15-8-3-1-7(2-4-8)12(17)18;/h5-8H,1-4H2,(H,14,15)(H,17,18);1H |
| InChIKey | JWSJKHICIZQWIH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|