C12H12FIN2O4 — CID 106322050
cis-(1R,3S)-3-(5-fluoro-4-iodo-2-nitroanilino)cyclopentane-1-carboxylic acid (PubChem CID 106322050) has the molecular formula C12H12FIN2O4 and a molecular weight of 394.14 g/mol. Its IUPAC name is cis-(1R,3S)-3-(5-fluoro-4-iodo-2-nitroanilino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(5-fluoro-4-iodo-2-nitroanilino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106322050 |
| Molecular Formula | C12H12FIN2O4 |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | cis-(1R,3S)-3-(5-fluoro-4-iodo-2-nitroanilino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](Nc2cc(F)c(I)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H12FIN2O4/c13-8-4-10(11(16(19)20)5-9(8)14)15-7-2-1-6(3-7)12(17)18/h4-7,15H,1-3H2,(H,17,18)/t6-,7+/m1/s1 |
| InChIKey | ACLFPIAANZADRC-RQJHMYQMSA-N |
| XLogP | 3.00 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|