C19H22F4N4O3 — CID 162118777
2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;N-cyclopropyl-4,5-difluoro-2-nitroaniline;methanol (PubChem CID 162118777) has the molecular formula C19H22F4N4O3 and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;N-cyclopropyl-4,5-difluoro-2-nitroaniline;methanol.
| Compound Name | 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;N-cyclopropyl-4,5-difluoro-2-nitroaniline;methanol |
|---|---|
| PubChem CID | 162118777 |
| Molecular Formula | C19H22F4N4O3 |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-N-cyclopropyl-4,5-difluorobenzene-1,2-diamine;N-cyclopropyl-4,5-difluoro-2-nitroaniline;methanol |
| SMILES | CO.Nc1cc(F)c(F)cc1NC1CC1.O=[N+]([O-])c1cc(F)c(F)cc1NC1CC1 |
| InChI | InChI=1S/C9H8F2N2O2.C9H10F2N2.CH4O/c10-6-3-8(12-5-1-2-5)9(13(14)15)4-7(6)11;10-6-3-8(12)9(4-7(6)11)13-5-1-2-5;1-2/h3-5,12H,1-2H2;3-5,13H,1-2,12H2;2H,1H3 |
| InChIKey | ZHCYRHDVCVLXHA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|