C12H15ClFN3O2 — CID 66079309
4-N-(4-chloro-5-fluoro-2-nitrophenyl)cyclohexane-1,4-diamine (PubChem CID 66079309) has the molecular formula C12H15ClFN3O2 and a molecular weight of 287.72 g/mol. Its IUPAC name is 4-N-(4-chloro-5-fluoro-2-nitrophenyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(4-chloro-5-fluoro-2-nitrophenyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 66079309 |
| Molecular Formula | C12H15ClFN3O2 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-N-(4-chloro-5-fluoro-2-nitrophenyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2cc(F)c(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H15ClFN3O2/c13-9-5-12(17(18)19)11(6-10(9)14)16-8-3-1-7(15)2-4-8/h5-8,16H,1-4,15H2 |
| InChIKey | ZPLPGCBGYPJTLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|