C12H10ClN5O — CID 171659479
5-(2-amino-5-chloro-4-pyridinyl)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 171659479) has the molecular formula C12H10ClN5O and a molecular weight of 275.70 g/mol. Its IUPAC name is 5-(2-amino-5-chloro-4-pyridinyl)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one.
| Compound Name | 5-(2-amino-5-chloro-4-pyridinyl)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 171659479 |
| Molecular Formula | C12H10ClN5O |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-(2-amino-5-chloro-4-pyridinyl)-2-methyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cn1[nH]c2ncc(-c3cc(N)ncc3Cl)cc2c1=O |
| InChI | InChI=1S/C12H10ClN5O/c1-18-12(19)8-2-6(4-16-11(8)17-18)7-3-10(14)15-5-9(7)13/h2-5H,1H3,(H2,14,15)(H,16,17) |
| InChIKey | VFAUAARHOZCARC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|