C16H13ClFN5 — CID 67980486
6-(2-amino-5-chloro-4-pyridinyl)-N-[(4-fluorophenyl)methyl]pyrazin-2-amine (PubChem CID 67980486) has the molecular formula C16H13ClFN5 and a molecular weight of 329.77 g/mol. Its IUPAC name is 6-(2-amino-5-chloro-4-pyridinyl)-N-[(4-fluorophenyl)methyl]pyrazin-2-amine.
| Compound Name | 6-(2-amino-5-chloro-4-pyridinyl)-N-[(4-fluorophenyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 67980486 |
| Molecular Formula | C16H13ClFN5 |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 6-(2-amino-5-chloro-4-pyridinyl)-N-[(4-fluorophenyl)methyl]pyrazin-2-amine |
| SMILES | Nc1cc(-c2cncc(NCc3ccc(F)cc3)n2)c(Cl)cn1 |
| InChI | InChI=1S/C16H13ClFN5/c17-13-7-21-15(19)5-12(13)14-8-20-9-16(23-14)22-6-10-1-3-11(18)4-2-10/h1-5,7-9H,6H2,(H2,19,21)(H,22,23) |
| InChIKey | YFNLNPBIZWEOHR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |