C11H13FN6 — CID 80943551
4-N-[(4-fluorophenyl)methyl]-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80943551) has the molecular formula C11H13FN6 and a molecular weight of 248.27 g/mol. Its IUPAC name is 4-N-[(4-fluorophenyl)methyl]-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(4-fluorophenyl)methyl]-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80943551 |
| Molecular Formula | C11H13FN6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-N-[(4-fluorophenyl)methyl]-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | NNc1cc(NCc2ccc(F)cc2)nc(N)n1 |
| InChI | InChI=1S/C11H13FN6/c12-8-3-1-7(2-4-8)6-15-9-5-10(18-14)17-11(13)16-9/h1-5H,6,14H2,(H4,13,15,16,17,18) |
| InChIKey | PWYITICFXORLEN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|