C12H13F2N5 — CID 80904358
N-[(3,4-difluorophenyl)methyl]-6-hydrazinyl-2-methylpyrimidin-4-amine (PubChem CID 80904358) has the molecular formula C12H13F2N5 and a molecular weight of 265.27 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-6-hydrazinyl-2-methylpyrimidin-4-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-6-hydrazinyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80904358 |
| Molecular Formula | C12H13F2N5 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-6-hydrazinyl-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NN)cc(NCc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C12H13F2N5/c1-7-17-11(5-12(18-7)19-15)16-6-8-2-3-9(13)10(14)4-8/h2-5H,6,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | PEVFINMRBZKHOA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|