C13H18N4O2 — CID 66716343
5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (PubChem CID 66716343) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
| Compound Name | 5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
|---|---|
| PubChem CID | 66716343 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-(4-methoxycyclohexyl)-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| SMILES | COC1CCC(N2C(=O)CNc3nccnc32)CC1 |
| InChI | InChI=1S/C13H18N4O2/c1-19-10-4-2-9(3-5-10)17-11(18)8-16-12-13(17)15-7-6-14-12/h6-7,9-10H,2-5,8H2,1H3,(H,14,16) |
| InChIKey | PSOULGDORDHHTR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |