C24H30N6O5 — CID 160929911
4-(1-tert-butylpiperidin-4-yl)-6-methoxy-1,2-dihydropyrido[2,3-b]pyrazin-3-one;1H-pyrido[2,3-b][1,4]oxazine-2,3-dione (PubChem CID 160929911) has the molecular formula C24H30N6O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-(1-tert-butylpiperidin-4-yl)-6-methoxy-1,2-dihydropyrido[2,3-b]pyrazin-3-one;1H-pyrido[2,3-b][1,4]oxazine-2,3-dione.
| Compound Name | 4-(1-tert-butylpiperidin-4-yl)-6-methoxy-1,2-dihydropyrido[2,3-b]pyrazin-3-one;1H-pyrido[2,3-b][1,4]oxazine-2,3-dione |
|---|---|
| PubChem CID | 160929911 |
| Molecular Formula | C24H30N6O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 4-(1-tert-butylpiperidin-4-yl)-6-methoxy-1,2-dihydropyrido[2,3-b]pyrazin-3-one;1H-pyrido[2,3-b][1,4]oxazine-2,3-dione |
| SMILES | COc1ccc2c(n1)N(C1CCN(C(C)(C)C)CC1)C(=O)CN2.O=c1[nH]c2cccnc2oc1=O |
| InChI | InChI=1S/C17H26N4O2.C7H4N2O3/c1-17(2,3)20-9-7-12(8-10-20)21-15(22)11-18-13-5-6-14(23-4)19-16(13)21;10-5-7(11)12-6-4(9-5)2-1-3-8-6/h5-6,12,18H,7-11H2,1-4H3;1-3H,(H,9,10) |
| InChIKey | STCXRDNDEZIKIL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|