C12H15N3O3 — CID 115323552
4,12-dimethoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one (PubChem CID 115323552) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4,12-dimethoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one.
| Compound Name | 4,12-dimethoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one |
|---|---|
| PubChem CID | 115323552 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4,12-dimethoxy-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-7-one |
| SMILES | COc1ccc2c(n1)N1CC(OC)CC1C(=O)N2 |
| InChI | InChI=1S/C12H15N3O3/c1-17-7-5-9-12(16)13-8-3-4-10(18-2)14-11(8)15(9)6-7/h3-4,7,9H,5-6H2,1-2H3,(H,13,16) |
| InChIKey | JZRLXXBUZLGWKN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |