C14H21N5O — CID 59825914
3-(1-tert-butylpiperidin-4-yl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 59825914) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-(1-tert-butylpiperidin-4-yl)-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 3-(1-tert-butylpiperidin-4-yl)-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 59825914 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 3-(1-tert-butylpiperidin-4-yl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | CC(C)(C)N1CCC(n2c(=O)[nH]c3nccnc32)CC1 |
| InChI | InChI=1S/C14H21N5O/c1-14(2,3)18-8-4-10(5-9-18)19-12-11(17-13(19)20)15-6-7-16-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,15,17,20) |
| InChIKey | FGWSOXGBLUSWBS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |