C5H4N4O2 — CID 143208981
3-hydroxy-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 143208981) has the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. Its IUPAC name is 3-hydroxy-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 3-hydroxy-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 143208981 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 3-hydroxy-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2nccnc2n1O |
| InChI | InChI=1S/C5H4N4O2/c10-5-8-3-4(9(5)11)7-2-1-6-3/h1-2,11H,(H,6,8,10) |
| InChIKey | AZWZTXRCLUAFQG-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|