C16H21N5O3 — CID 154882570
3-cyclopropyl-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 154882570) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-cyclopropyl-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-cyclopropyl-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154882570 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-cyclopropyl-1-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | COc1ccnc(N2CCC(N3CC(=O)N(C4CC4)C3=O)CC2)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-24-13-4-7-17-15(18-13)19-8-5-11(6-9-19)20-10-14(22)21(16(20)23)12-2-3-12/h4,7,11-12H,2-3,5-6,8-10H2,1H3 |
| InChIKey | KRTMLVWCWORFHS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|