C19H29N5O3 — CID 97343887
(3R)-3-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one (PubChem CID 97343887) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3R)-3-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one.
| Compound Name | (3R)-3-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 97343887 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (3R)-3-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one |
| SMILES | COc1ccnc(N2CCN([C@@H]3CCCN(C4CCOCC4)C3=O)CC2)n1 |
| InChI | InChI=1S/C19H29N5O3/c1-26-17-4-7-20-19(21-17)23-11-9-22(10-12-23)16-3-2-8-24(18(16)25)15-5-13-27-14-6-15/h4,7,15-16H,2-3,5-6,8-14H2,1H3/t16-/m1/s1 |
| InChIKey | CHIQJOCASWQKPX-MRXNPFEDSA-N |
| XLogP | 0.78 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |