C13H20N4OS — CID 131891424
4-methoxy-2-[4-(thiolan-3-yl)piperazin-1-yl]pyrimidine (PubChem CID 131891424) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-methoxy-2-[4-(thiolan-3-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-methoxy-2-[4-(thiolan-3-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 131891424 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-methoxy-2-[4-(thiolan-3-yl)piperazin-1-yl]pyrimidine |
| SMILES | COc1ccnc(N2CCN(C3CCSC3)CC2)n1 |
| InChI | InChI=1S/C13H20N4OS/c1-18-12-2-4-14-13(15-12)17-7-5-16(6-8-17)11-3-9-19-10-11/h2,4,11H,3,5-10H2,1H3 |
| InChIKey | DHTZQVNPMAVHQI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |