C15H21N7O — CID 154575618
N-ethyl-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 154575618) has the molecular formula C15H21N7O and a molecular weight of 315.38 g/mol. Its IUPAC name is N-ethyl-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-ethyl-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154575618 |
| Molecular Formula | C15H21N7O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-ethyl-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | CCNc1ccnc(N2CCN(c3nccc(OC)n3)CC2)n1 |
| InChI | InChI=1S/C15H21N7O/c1-3-16-12-4-6-17-14(19-12)21-8-10-22(11-9-21)15-18-7-5-13(20-15)23-2/h4-7H,3,8-11H2,1-2H3,(H,16,17,19) |
| InChIKey | NGNHMOIGDGQJCJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |