C11H19N5 — CID 121204945
2-(1,4-diazepan-1-yl)-N-ethylpyrimidin-4-amine (PubChem CID 121204945) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-ethylpyrimidin-4-amine.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 121204945 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-ethylpyrimidin-4-amine |
| SMILES | CCNc1ccnc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C11H19N5/c1-2-13-10-4-6-14-11(15-10)16-8-3-5-12-7-9-16/h4,6,12H,2-3,5,7-9H2,1H3,(H,13,14,15) |
| InChIKey | MCAHBXPHIUELLA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |