C17H23N7O2 — CID 154575576
4-[6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-yl]morpholine (PubChem CID 154575576) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-[6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 154575576 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-[6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]pyrimidin-4-yl]morpholine |
| SMILES | COc1ccnc(N2CCN(c3cc(N4CCOCC4)ncn3)CC2)n1 |
| InChI | InChI=1S/C17H23N7O2/c1-25-16-2-3-18-17(21-16)24-6-4-22(5-7-24)14-12-15(20-13-19-14)23-8-10-26-11-9-23/h2-3,12-13H,4-11H2,1H3 |
| InChIKey | SCDILOZBANVSKG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 79.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |