C18H26N6O — CID 154582519
4-tert-butyl-6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine (PubChem CID 154582519) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-tert-butyl-6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine.
| Compound Name | 4-tert-butyl-6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 154582519 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 4-tert-butyl-6-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine |
| SMILES | COc1ccnc(N2CCN(c3cc(C(C)(C)C)nc(C)n3)CC2)n1 |
| InChI | InChI=1S/C18H26N6O/c1-13-20-14(18(2,3)4)12-15(21-13)23-8-10-24(11-9-23)17-19-7-6-16(22-17)25-5/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | CKJDFFATUPNJGT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |