C17H23ClN6 — CID 154582470
4-tert-butyl-6-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine (PubChem CID 154582470) has the molecular formula C17H23ClN6 and a molecular weight of 346.87 g/mol. Its IUPAC name is 4-tert-butyl-6-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine.
| Compound Name | 4-tert-butyl-6-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 154582470 |
| Molecular Formula | C17H23ClN6 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-tert-butyl-6-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-methylpyrimidine |
| SMILES | Cc1nc(N2CCN(c3ncc(Cl)cn3)CC2)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C17H23ClN6/c1-12-21-14(17(2,3)4)9-15(22-12)23-5-7-24(8-6-23)16-19-10-13(18)11-20-16/h9-11H,5-8H2,1-4H3 |
| InChIKey | ATWGOIUFGDWCJD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |