C13H21N3O3S — CID 147484596
4-[2-methyl-6-(2-methylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine (PubChem CID 147484596) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[2-methyl-6-(2-methylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-methyl-6-(2-methylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 147484596 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[2-methyl-6-(2-methylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine |
| SMILES | Cc1nc(N2CCOCC2)cc(C(C)(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C13H21N3O3S/c1-10-14-11(13(2,3)20(4,17)18)9-12(15-10)16-5-7-19-8-6-16/h9H,5-8H2,1-4H3 |
| InChIKey | FEIBXQFRSZUXQZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |