C17H26ClN3O3S — CID 163901660
4-[2-chloro-6-(2-cyclohexylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine (PubChem CID 163901660) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 4-[2-chloro-6-(2-cyclohexylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-chloro-6-(2-cyclohexylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 163901660 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[2-chloro-6-(2-cyclohexylsulfonylpropan-2-yl)pyrimidin-4-yl]morpholine |
| SMILES | CC(C)(c1cc(N2CCOCC2)nc(Cl)n1)S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H26ClN3O3S/c1-17(2,25(22,23)13-6-4-3-5-7-13)14-12-15(20-16(18)19-14)21-8-10-24-11-9-21/h12-13H,3-11H2,1-2H3 |
| InChIKey | QKJNTVBPVKUQBA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |