C15H20ClNO3S — CID 90106436
4-(3-chloro-4-cyclopentylsulfonylphenyl)morpholine (PubChem CID 90106436) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is 4-(3-chloro-4-cyclopentylsulfonylphenyl)morpholine.
| Compound Name | 4-(3-chloro-4-cyclopentylsulfonylphenyl)morpholine |
|---|---|
| PubChem CID | 90106436 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-(3-chloro-4-cyclopentylsulfonylphenyl)morpholine |
| SMILES | O=S(=O)(c1ccc(N2CCOCC2)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H20ClNO3S/c16-14-11-12(17-7-9-20-10-8-17)5-6-15(14)21(18,19)13-3-1-2-4-13/h5-6,11,13H,1-4,7-10H2 |
| InChIKey | LVXAUTONBZMITE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |