C14H21ClN4O3S — CID 174644321
4-[2-chloro-6-(4-methylsulfonylpiperidin-4-yl)pyrimidin-4-yl]morpholine (PubChem CID 174644321) has the molecular formula C14H21ClN4O3S and a molecular weight of 360.87 g/mol. Its IUPAC name is 4-[2-chloro-6-(4-methylsulfonylpiperidin-4-yl)pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-chloro-6-(4-methylsulfonylpiperidin-4-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 174644321 |
| Molecular Formula | C14H21ClN4O3S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-[2-chloro-6-(4-methylsulfonylpiperidin-4-yl)pyrimidin-4-yl]morpholine |
| SMILES | CS(=O)(=O)C1(c2cc(N3CCOCC3)nc(Cl)n2)CCNCC1 |
| InChI | InChI=1S/C14H21ClN4O3S/c1-23(20,21)14(2-4-16-5-3-14)11-10-12(18-13(15)17-11)19-6-8-22-9-7-19/h10,16H,2-9H2,1H3 |
| InChIKey | VZNHBNUCLRIXOH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |