C13H19ClN4O2S — CID 167996467
(PubChem CID 167996467) has the molecular formula C13H19ClN4O2S and a molecular weight of 330.84 g/mol.
| Compound Name | |
|---|---|
| PubChem CID | 167996467 |
| Molecular Formula | C13H19ClN4O2S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | — |
| SMILES | [H]N=S(C)(=O)C1(c2cc(N3CCOCC3C)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C13H19ClN4O2S/c1-9-8-20-6-5-18(9)11-7-10(16-12(14)17-11)13(3-4-13)21(2,15)19/h7,9,15H,3-6,8H2,1-2H3 |
| InChIKey | QTQBSOLQWXAFRV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |