C15H22ClN3O3S — CID 174603748
[1-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]cyclopentyl]methanesulfinic acid (PubChem CID 174603748) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is [1-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]cyclopentyl]methanesulfinic acid.
| Compound Name | [1-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]cyclopentyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174603748 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [1-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]cyclopentyl]methanesulfinic acid |
| SMILES | C[C@H]1COCCN1c1cc(C2(CS(=O)O)CCCC2)nc(Cl)n1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-11-9-22-7-6-19(11)13-8-12(17-14(16)18-13)15(10-23(20)21)4-2-3-5-15/h8,11H,2-7,9-10H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | NNTJBVBDXUJCHQ-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|