C11H13ClN4O — CID 169304968
(3R)-4-[2-chloro-6-(isocyanomethyl)pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 169304968) has the molecular formula C11H13ClN4O and a molecular weight of 252.70 g/mol. Its IUPAC name is (3R)-4-[2-chloro-6-(isocyanomethyl)pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[2-chloro-6-(isocyanomethyl)pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 169304968 |
| Molecular Formula | C11H13ClN4O |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (3R)-4-[2-chloro-6-(isocyanomethyl)pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | [C-]#[N+]Cc1cc(N2CCOC[C@H]2C)nc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN4O/c1-8-7-17-4-3-16(8)10-5-9(6-13-2)14-11(12)15-10/h5,8H,3-4,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | ONSGLSWYFNXKHN-MRVPVSSYSA-N |
| XLogP | 1.77 |
| TPSA | 42.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|