C15H17ClN4OS — CID 59380226
(3S)-4-[2-chloro-6-(pyridin-2-ylsulfanylmethyl)pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 59380226) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is (3S)-4-[2-chloro-6-(pyridin-2-ylsulfanylmethyl)pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | (3S)-4-[2-chloro-6-(pyridin-2-ylsulfanylmethyl)pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 59380226 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3S)-4-[2-chloro-6-(pyridin-2-ylsulfanylmethyl)pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1c1cc(CSc2ccccn2)nc(Cl)n1 |
| InChI | InChI=1S/C15H17ClN4OS/c1-11-9-21-7-6-20(11)13-8-12(18-15(16)19-13)10-22-14-4-2-3-5-17-14/h2-5,8,11H,6-7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | ZOIZAZQXWUPISL-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |