C16H19ClN3OS+ — CID 143742143
[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methyl-phenylsulfanium (PubChem CID 143742143) has the molecular formula C16H19ClN3OS+ and a molecular weight of 336.87 g/mol. Its IUPAC name is [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methyl-phenylsulfanium.
| Compound Name | [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methyl-phenylsulfanium |
|---|---|
| PubChem CID | 143742143 |
| Molecular Formula | C16H19ClN3OS+ |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methyl-phenylsulfanium |
| SMILES | C[C@H]1COCCN1c1cc(C[SH+]c2ccccc2)nc(Cl)n1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-12-10-21-8-7-20(12)15-9-13(18-16(17)19-15)11-22-14-5-3-2-4-6-14/h2-6,9,12H,7-8,10-11H2,1H3/p+1/t12-/m0/s1 |
| InChIKey | HDKLQJOFYJZSOY-LBPRGKRZSA-O |
| XLogP | 2.73 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|