C15H17ClN4OS — CID 87543945
[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]-pyridin-2-ylmethanethiol (PubChem CID 87543945) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]-pyridin-2-ylmethanethiol.
| Compound Name | [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]-pyridin-2-ylmethanethiol |
|---|---|
| PubChem CID | 87543945 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]-pyridin-2-ylmethanethiol |
| SMILES | C[C@H]1COCCN1c1cc(C(S)c2ccccn2)nc(Cl)n1 |
| InChI | InChI=1S/C15H17ClN4OS/c1-10-9-21-7-6-20(10)13-8-12(18-15(16)19-13)14(22)11-4-2-3-5-17-11/h2-5,8,10,14,22H,6-7,9H2,1H3/t10-,14?/m0/s1 |
| InChIKey | CQHHDFZCLCWLND-XLLULAGJSA-N |
| XLogP | 2.77 |
| TPSA | 51.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|