C17H15Cl2N4O3S- — CID 174603756
(2-chloro-4-cyanophenyl)-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methanesulfinate (PubChem CID 174603756) has the molecular formula C17H15Cl2N4O3S- and a molecular weight of 426.31 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl)-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methanesulfinate.
| Compound Name | (2-chloro-4-cyanophenyl)-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methanesulfinate |
|---|---|
| PubChem CID | 174603756 |
| Molecular Formula | C17H15Cl2N4O3S- |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (2-chloro-4-cyanophenyl)-[2-chloro-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-4-yl]methanesulfinate |
| SMILES | C[C@H]1COCCN1c1cc(C(c2ccc(C#N)cc2Cl)S(=O)[O-])nc(Cl)n1 |
| InChI | InChI=1S/C17H16Cl2N4O3S/c1-10-9-26-5-4-23(10)15-7-14(21-17(19)22-15)16(27(24)25)12-3-2-11(8-20)6-13(12)18/h2-3,6-7,10,16H,4-5,9H2,1H3,(H,24,25)/p-1/t10-,16?/m0/s1 |
| InChIKey | ZTSOTVYFGOEEQJ-VQVVDHBBSA-M |
| XLogP | 2.85 |
| TPSA | 102.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|