C14H19ClN3O3S- — CID 175267852
[1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclopentyl]methanesulfinate (PubChem CID 175267852) has the molecular formula C14H19ClN3O3S- and a molecular weight of 344.84 g/mol. Its IUPAC name is [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclopentyl]methanesulfinate.
| Compound Name | [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclopentyl]methanesulfinate |
|---|---|
| PubChem CID | 175267852 |
| Molecular Formula | C14H19ClN3O3S- |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclopentyl]methanesulfinate |
| SMILES | O=S([O-])CC1(c2cc(N3CCOCC3)nc(Cl)n2)CCCC1 |
| InChI | InChI=1S/C14H20ClN3O3S/c15-13-16-11(14(10-22(19)20)3-1-2-4-14)9-12(17-13)18-5-7-21-8-6-18/h9H,1-8,10H2,(H,19,20)/p-1 |
| InChIKey | RUQWKHSKIPBHRI-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|