C18H20ClFN3OS+ — CID 143741808
[1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclobutyl]-(4-fluorophenyl)sulfanium (PubChem CID 143741808) has the molecular formula C18H20ClFN3OS+ and a molecular weight of 380.90 g/mol. Its IUPAC name is [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclobutyl]-(4-fluorophenyl)sulfanium.
| Compound Name | [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclobutyl]-(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 143741808 |
| Molecular Formula | C18H20ClFN3OS+ |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [1-(2-chloro-6-morpholin-4-ylpyrimidin-4-yl)cyclobutyl]-(4-fluorophenyl)sulfanium |
| SMILES | Fc1ccc([SH+]C2(c3cc(N4CCOCC4)nc(Cl)n3)CCC2)cc1 |
| InChI | InChI=1S/C18H19ClFN3OS/c19-17-21-15(12-16(22-17)23-8-10-24-11-9-23)18(6-1-7-18)25-14-4-2-13(20)3-5-14/h2-5,12H,1,6-11H2/p+1 |
| InChIKey | ZODVFXVFSWPASQ-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|