C16H23ClN2O4S — CID 166927953
(3R)-4-[6-chloro-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-methylmorpholine (PubChem CID 166927953) has the molecular formula C16H23ClN2O4S and a molecular weight of 374.89 g/mol. Its IUPAC name is (3R)-4-[6-chloro-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-methylmorpholine.
| Compound Name | (3R)-4-[6-chloro-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 166927953 |
| Molecular Formula | C16H23ClN2O4S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (3R)-4-[6-chloro-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-methylmorpholine |
| SMILES | C[C@@H]1COCCN1c1cc(C2(S(C)(=O)=O)CCOCC2)cc(Cl)n1 |
| InChI | InChI=1S/C16H23ClN2O4S/c1-12-11-23-8-5-19(12)15-10-13(9-14(17)18-15)16(24(2,20)21)3-6-22-7-4-16/h9-10,12H,3-8,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | WLJWQJGZEILYHN-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|