C17H25BrN2O4S — CID 138688370
(3S)-4-[6-bromo-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-ethylmorpholine (PubChem CID 138688370) has the molecular formula C17H25BrN2O4S and a molecular weight of 433.37 g/mol. Its IUPAC name is (3S)-4-[6-bromo-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-ethylmorpholine.
| Compound Name | (3S)-4-[6-bromo-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-ethylmorpholine |
|---|---|
| PubChem CID | 138688370 |
| Molecular Formula | C17H25BrN2O4S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (3S)-4-[6-bromo-4-(4-methylsulfonyloxan-4-yl)-2-pyridinyl]-3-ethylmorpholine |
| SMILES | CC[C@H]1COCCN1c1cc(C2(S(C)(=O)=O)CCOCC2)cc(Br)n1 |
| InChI | InChI=1S/C17H25BrN2O4S/c1-3-14-12-24-9-6-20(14)16-11-13(10-15(18)19-16)17(25(2,21)22)4-7-23-8-5-17/h10-11,14H,3-9,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | NGEHHPGZTABGLV-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|