C28H34BrN3O5S — CID 138699223
1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]methanesulfonamide (PubChem CID 138699223) has the molecular formula C28H34BrN3O5S and a molecular weight of 604.57 g/mol. Its IUPAC name is 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]methanesulfonamide.
| Compound Name | 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 138699223 |
| Molecular Formula | C28H34BrN3O5S |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]methanesulfonamide |
| SMILES | CC[C@H]1COCCN1c1cc(CS(=O)(=O)N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)cc(Br)n1 |
| InChI | InChI=1S/C28H34BrN3O5S/c1-4-24-19-37-14-13-32(24)28-16-23(15-27(29)30-28)20-38(33,34)31(17-21-5-9-25(35-2)10-6-21)18-22-7-11-26(36-3)12-8-22/h5-12,15-16,24H,4,13-14,17-20H2,1-3H3/t24-/m0/s1 |
| InChIKey | UWDPDFLZTYSUDD-DEOSSOPVSA-N |
| XLogP | 5.01 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|