C14H22BrN3O3S — CID 142605138
1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-dimethylmethanesulfonamide (PubChem CID 142605138) has the molecular formula C14H22BrN3O3S and a molecular weight of 392.32 g/mol. Its IUPAC name is 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 142605138 |
| Molecular Formula | C14H22BrN3O3S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 1-[2-bromo-6-[(3S)-3-ethylmorpholin-4-yl]-4-pyridinyl]-N,N-dimethylmethanesulfonamide |
| SMILES | CC[C@H]1COCCN1c1cc(CS(=O)(=O)N(C)C)cc(Br)n1 |
| InChI | InChI=1S/C14H22BrN3O3S/c1-4-12-9-21-6-5-18(12)14-8-11(7-13(15)16-14)10-22(19,20)17(2)3/h7-8,12H,4-6,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VGKNLHNYMKYVRZ-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|