C13H19N2NaO5S2 — CID 142605101
sodium 6-[(3S)-3-ethylmorpholin-4-yl]-4-(methylsulfonylmethyl)pyridine-2-sulfinate (PubChem CID 142605101) has the molecular formula C13H19N2NaO5S2 and a molecular weight of 370.43 g/mol. Its IUPAC name is sodium 6-[(3S)-3-ethylmorpholin-4-yl]-4-(methylsulfonylmethyl)pyridine-2-sulfinate.
| Compound Name | sodium 6-[(3S)-3-ethylmorpholin-4-yl]-4-(methylsulfonylmethyl)pyridine-2-sulfinate |
|---|---|
| PubChem CID | 142605101 |
| Molecular Formula | C13H19N2NaO5S2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | sodium 6-[(3S)-3-ethylmorpholin-4-yl]-4-(methylsulfonylmethyl)pyridine-2-sulfinate |
| SMILES | CC[C@H]1COCCN1c1cc(CS(C)(=O)=O)cc(S(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C13H20N2O5S2.Na/c1-3-11-8-20-5-4-15(11)12-6-10(9-22(2,18)19)7-13(14-12)21(16)17;/h6-7,11H,3-5,8-9H2,1-2H3,(H,16,17);/q;+1/p-1/t11-;/m0./s1 |
| InChIKey | ICEVRDHQKLNXET-MERQFXBCSA-M |
| XLogP | -2.52 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|