C17H27N2NaO6S2 — CID 175050986
sodium;6-[(3S)-3-ethylmorpholin-4-yl]-4-(4-methylsulfonyloxan-4-yl)pyridine-2-sulfinic acid;hydride (PubChem CID 175050986) has the molecular formula C17H27N2NaO6S2 and a molecular weight of 442.54 g/mol. Its IUPAC name is sodium;6-[(3S)-3-ethylmorpholin-4-yl]-4-(4-methylsulfonyloxan-4-yl)pyridine-2-sulfinic acid;hydride.
| Compound Name | sodium;6-[(3S)-3-ethylmorpholin-4-yl]-4-(4-methylsulfonyloxan-4-yl)pyridine-2-sulfinic acid;hydride |
|---|---|
| PubChem CID | 175050986 |
| Molecular Formula | C17H27N2NaO6S2 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | sodium;6-[(3S)-3-ethylmorpholin-4-yl]-4-(4-methylsulfonyloxan-4-yl)pyridine-2-sulfinic acid;hydride |
| SMILES | CC[C@H]1COCCN1c1cc(C2(S(C)(=O)=O)CCOCC2)cc(S(=O)O)n1.[H-].[Na+] |
| InChI | InChI=1S/C17H26N2O6S2.Na.H/c1-3-14-12-25-9-6-19(14)15-10-13(11-16(18-15)26(20)21)17(27(2,22)23)4-7-24-8-5-17;;/h10-11,14H,3-9,12H2,1-2H3,(H,20,21);;/q;+1;-1/t14-;;/m0../s1 |
| InChIKey | HKINYILANRQZPA-UTLKBRERSA-N |
| XLogP | -1.56 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|