C13H19ClN2O3S — CID 166928268
(3R)-4-[6-chloro-5-methyl-4-(methylsulfonylmethyl)-2-pyridinyl]-3-methylmorpholine (PubChem CID 166928268) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is (3R)-4-[6-chloro-5-methyl-4-(methylsulfonylmethyl)-2-pyridinyl]-3-methylmorpholine.
| Compound Name | (3R)-4-[6-chloro-5-methyl-4-(methylsulfonylmethyl)-2-pyridinyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 166928268 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (3R)-4-[6-chloro-5-methyl-4-(methylsulfonylmethyl)-2-pyridinyl]-3-methylmorpholine |
| SMILES | Cc1c(CS(C)(=O)=O)cc(N2CCOC[C@H]2C)nc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9-7-19-5-4-16(9)12-6-11(8-20(3,17)18)10(2)13(14)15-12/h6,9H,4-5,7-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | RPIRXMCKGCMCHZ-SECBINFHSA-N |
| XLogP | 1.81 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|